C24H18F6N2O8S2 — CID 23557622
bis[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] benzene-1,3-disulfonate (PubChem CID 23557622) has the molecular formula C24H18F6N2O8S2 and a molecular weight of 640.54 g/mol. Its IUPAC name is bis[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] benzene-1,3-disulfonate.
| Compound Name | bis[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 23557622 |
| Molecular Formula | C24H18F6N2O8S2 |
| Molecular Weight | 640.54 g/mol |
| Exact Mass | 640.04 |
| IUPAC Name | bis[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] benzene-1,3-disulfonate |
| SMILES | COc1ccc(/C(=N/OS(=O)(=O)c2cccc(S(=O)(=O)O/N=C(/c3ccc(OC)cc3)C(F)(F)F)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H18F6N2O8S2/c1-37-17-10-6-15(7-11-17)21(23(25,26)27)31-39-41(33,34)19-4-3-5-20(14-19)42(35,36)40-32-22(24(28,29)30)16-8-12-18(38-2)13-9-16/h3-14H,1-2H3/b31-21-,32-22- |
| InChIKey | MXMYHQFQYCDUBB-RYJWMXFHSA-N |
| XLogP | 5.05 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|