C22H18F3NO8S2 — CID 59115180
[4-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 4-methoxybenzenesulfonate (PubChem CID 59115180) has the molecular formula C22H18F3NO8S2 and a molecular weight of 545.51 g/mol. Its IUPAC name is [4-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 4-methoxybenzenesulfonate.
| Compound Name | [4-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 59115180 |
| Molecular Formula | C22H18F3NO8S2 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | [4-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(C(=NOS(=O)(=O)c2ccc(OS(=O)(=O)c3ccc(OC)cc3)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F3NO8S2/c1-31-16-5-3-15(4-6-16)21(22(23,24)25)26-34-36(29,30)20-13-9-18(10-14-20)33-35(27,28)19-11-7-17(32-2)8-12-19/h3-14H,1-2H3 |
| InChIKey | IQKWGYUQDYTZBV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 117.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|