C23H20F2O4S — CID 132564559
[(Z)-3,3-difluoro-3-(4-methoxyphenyl)-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 132564559) has the molecular formula C23H20F2O4S and a molecular weight of 430.47 g/mol. Its IUPAC name is [(Z)-3,3-difluoro-3-(4-methoxyphenyl)-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-3,3-difluoro-3-(4-methoxyphenyl)-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 132564559 |
| Molecular Formula | C23H20F2O4S |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [(Z)-3,3-difluoro-3-(4-methoxyphenyl)-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(C(F)(F)/C(=C/c2ccccc2)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H20F2O4S/c1-17-8-14-21(15-9-17)30(26,27)29-22(16-18-6-4-3-5-7-18)23(24,25)19-10-12-20(28-2)13-11-19/h3-16H,1-2H3/b22-16- |
| InChIKey | NFSDQKBHIUQESW-JWGURIENSA-N |
| XLogP | 5.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|