C21H16F3NO7S2 — CID 59115138
[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 4-(benzenesulfonyloxy)benzenesulfonate (PubChem CID 59115138) has the molecular formula C21H16F3NO7S2 and a molecular weight of 515.49 g/mol. Its IUPAC name is [[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 4-(benzenesulfonyloxy)benzenesulfonate.
| Compound Name | [[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 4-(benzenesulfonyloxy)benzenesulfonate |
|---|---|
| PubChem CID | 59115138 |
| Molecular Formula | C21H16F3NO7S2 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | [[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 4-(benzenesulfonyloxy)benzenesulfonate |
| SMILES | COc1ccc(C(=NOS(=O)(=O)c2ccc(OS(=O)(=O)c3ccccc3)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F3NO7S2/c1-30-16-9-7-15(8-10-16)20(21(22,23)24)25-32-34(28,29)19-13-11-17(12-14-19)31-33(26,27)18-5-3-2-4-6-18/h2-14H,1H3 |
| InChIKey | IJCCYXPFJZIKBG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|