C22H18F3NO7S2 — CID 59115155
[4-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate (PubChem CID 59115155) has the molecular formula C22H18F3NO7S2 and a molecular weight of 529.51 g/mol. Its IUPAC name is [4-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59115155 |
| Molecular Formula | C22H18F3NO7S2 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | [4-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(C(=NOS(=O)(=O)c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F3NO7S2/c1-15-3-11-19(12-4-15)34(27,28)32-18-9-13-20(14-10-18)35(29,30)33-26-21(22(23,24)25)16-5-7-17(31-2)8-6-16/h3-14H,1-2H3 |
| InChIKey | YDDLKRQCPPNBNF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|