About 2-methyltriazol-4-amine;hydrobromide
2-methyltriazol-4-amine;hydrobromide (PubChem CID 91828094) has the molecular formula C3H7BrN4
and a molecular weight of 179.02 g/mol. Its IUPAC name is 2-methyltriazol-4-amine;hydrobromide.
Molecular Properties
| Compound Name | 2-methyltriazol-4-amine;hydrobromide |
| PubChem CID | 91828094 |
| Molecular Formula | C3H7BrN4 |
| Molecular Weight | 179.02 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | 2-methyltriazol-4-amine;hydrobromide |
| SMILES | Br.Cn1ncc(N)n1 |
| InChI | InChI=1S/C3H6N4.BrH/c1-7-5-2-3(4)6-7;/h2H,1H3,(H2,4,6);1H |
| InChIKey | GMCDZVXZCPDXIO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.02 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyltriazol-4-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyltriazol-4-amine;hydrobromide?
The IUPAC name of 2-methyltriazol-4-amine;hydrobromide (CID 91828094) is 2-methyltriazol-4-amine;hydrobromide.
What is the SMILES notation for 2-methyltriazol-4-amine;hydrobromide?
The canonical SMILES for 2-methyltriazol-4-amine;hydrobromide is Br.Cn1ncc(N)n1.
What is the InChIKey of 2-methyltriazol-4-amine;hydrobromide?
The InChIKey is GMCDZVXZCPDXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4.BrH/c1-7-5-2-3(4)6-7;/h2H,1H3,(H2,4,6);1H.
What are the key properties of 2-methyltriazol-4-amine;hydrobromide?
2-methyltriazol-4-amine;hydrobromide has a molecular weight of 179.02 g/mol, XLogP of -0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyltriazol-4-amine;hydrobromide is sourced from PubChem (CID 91828094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).