C19H23N3O3S — CID 9183075
N'-ethyl-N'-(4-methylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide (PubChem CID 9183075) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N'-ethyl-N'-(4-methylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide.
| Compound Name | N'-ethyl-N'-(4-methylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
|---|---|
| PubChem CID | 9183075 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N'-ethyl-N'-(4-methylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
| SMILES | CCN(NC(=O)c1ccc2c(c1)CCN2S(C)(=O)=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-4-21(17-8-5-14(2)6-9-17)20-19(23)16-7-10-18-15(13-16)11-12-22(18)26(3,24)25/h5-10,13H,4,11-12H2,1-3H3,(H,20,23) |
| InChIKey | CJZMMKNFNVJWKK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|