C18H21N3O4S2 — CID 9157935
N'-(5-ethyl-4-methylthiophene-2-carbonyl)-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide (PubChem CID 9157935) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N'-(5-ethyl-4-methylthiophene-2-carbonyl)-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide.
| Compound Name | N'-(5-ethyl-4-methylthiophene-2-carbonyl)-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
|---|---|
| PubChem CID | 9157935 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N'-(5-ethyl-4-methylthiophene-2-carbonyl)-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)c2ccc3c(c2)CCN3S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C18H21N3O4S2/c1-4-15-11(2)9-16(26-15)18(23)20-19-17(22)13-5-6-14-12(10-13)7-8-21(14)27(3,24)25/h5-6,9-10H,4,7-8H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | ZZZMQQXWKZJIME-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|