C18H11F3N2OS — CID 9183125
N-[(Z)-(3,4-difluorophenyl)methylideneamino]-5-(4-fluorophenyl)thiophene-2-carboxamide (PubChem CID 9183125) has the molecular formula C18H11F3N2OS and a molecular weight of 360.36 g/mol. Its IUPAC name is N-[(Z)-(3,4-difluorophenyl)methylideneamino]-5-(4-fluorophenyl)thiophene-2-carboxamide.
| Compound Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]-5-(4-fluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9183125 |
| Molecular Formula | C18H11F3N2OS |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]-5-(4-fluorophenyl)thiophene-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(F)c(F)c1)c1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H11F3N2OS/c19-13-4-2-12(3-5-13)16-7-8-17(25-16)18(24)23-22-10-11-1-6-14(20)15(21)9-11/h1-10H,(H,23,24)/b22-10- |
| InChIKey | JOOFNDAJTOAVOU-YVNNLAQVSA-N |
| XLogP | 4.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|