C20H15FN2O4S — CID 9182743
2-[2-[(Z)-[[5-(4-fluorophenyl)thiophene-2-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 9182743) has the molecular formula C20H15FN2O4S and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[2-[(Z)-[[5-(4-fluorophenyl)thiophene-2-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(Z)-[[5-(4-fluorophenyl)thiophene-2-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 9182743 |
| Molecular Formula | C20H15FN2O4S |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-[2-[(Z)-[[5-(4-fluorophenyl)thiophene-2-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1/C=N\NC(=O)c1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C20H15FN2O4S/c21-15-7-5-13(6-8-15)17-9-10-18(28-17)20(26)23-22-11-14-3-1-2-4-16(14)27-12-19(24)25/h1-11H,12H2,(H,23,26)(H,24,25)/b22-11- |
| InChIKey | AAGRMFZOFUYSCZ-JJFYIABZSA-N |
| XLogP | 3.78 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|