About N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide
N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide (PubChem CID 91832966) has the molecular formula C14H22N4O3
and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide |
| PubChem CID | 91832966 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCCN(CCn2c(=O)cc(C)[nH]c2=O)C1 |
| InChI | InChI=1S/C14H22N4O3/c1-10-8-13(20)18(14(21)15-10)7-6-17-5-3-4-12(9-17)16-11(2)19/h8,12H,3-7,9H2,1-2H3,(H,15,21)(H,16,19) |
| InChIKey | OZSVTCKGEVBPGM-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide?
The IUPAC name of N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide (CID 91832966) is N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide.
What is the SMILES notation for N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide?
The canonical SMILES for N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide is CC(=O)NC1CCCN(CCn2c(=O)cc(C)[nH]c2=O)C1.
What is the InChIKey of N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide?
The InChIKey is OZSVTCKGEVBPGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O3/c1-10-8-13(20)18(14(21)15-10)7-6-17-5-3-4-12(9-17)16-11(2)19/h8,12H,3-7,9H2,1-2H3,(H,15,21)(H,16,19).
What are the key properties of N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide?
N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide has a molecular weight of 294.35 g/mol, XLogP of -0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidin-3-yl]acetamide is sourced from PubChem (CID 91832966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).