About (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide
(3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide (PubChem CID 97003239) has the molecular formula C16H24N4O3
and a molecular weight of 320.39 g/mol. Its IUPAC name is (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide |
| PubChem CID | 97003239 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide |
| SMILES | CC(=O)N[C@H]1CCCN(C(=O)NCc2c(C)cc(C)[nH]c2=O)C1 |
| InChI | InChI=1S/C16H24N4O3/c1-10-7-11(2)18-15(22)14(10)8-17-16(23)20-6-4-5-13(9-20)19-12(3)21/h7,13H,4-6,8-9H2,1-3H3,(H,17,23)(H,18,22)(H,19,21)/t13-/m0/s1 |
| InChIKey | BTTAPJBAFSNFFQ-ZDUSSCGKSA-N |
| XLogP | 0.80 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide?
The IUPAC name of (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide (CID 97003239) is (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide.
What is the SMILES notation for (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide?
The canonical SMILES for (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide is CC(=O)N[C@H]1CCCN(C(=O)NCc2c(C)cc(C)[nH]c2=O)C1.
What is the InChIKey of (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide?
The InChIKey is BTTAPJBAFSNFFQ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H24N4O3/c1-10-7-11(2)18-15(22)14(10)8-17-16(23)20-6-4-5-13(9-20)19-12(3)21/h7,13H,4-6,8-9H2,1-3H3,(H,17,23)(H,18,22)(H,19,21)/t13-/m0/s1.
What are the key properties of (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide?
(3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide has a molecular weight of 320.39 g/mol, XLogP of 0.80, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-acetamido-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]piperidine-1-carboxamide is sourced from PubChem (CID 97003239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).