C19H24F3N3O — CID 91835242
[4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 91835242) has the molecular formula C19H24F3N3O and a molecular weight of 367.42 g/mol. Its IUPAC name is [4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 91835242 |
| Molecular Formula | C19H24F3N3O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)N1CCN(C2CN3CCC2CC3)CC1 |
| InChI | InChI=1S/C19H24F3N3O/c20-19(21,22)16-4-2-1-3-15(16)18(26)25-11-9-24(10-12-25)17-13-23-7-5-14(17)6-8-23/h1-4,14,17H,5-13H2 |
| InChIKey | ZWTBFIATHXOWTJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |