C20H26N2OS — CID 91837480
1-[4-(3-phenylpropyl)-1,4-diazepan-1-yl]-2-thiophen-3-ylethanone (PubChem CID 91837480) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 1-[4-(3-phenylpropyl)-1,4-diazepan-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[4-(3-phenylpropyl)-1,4-diazepan-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 91837480 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[4-(3-phenylpropyl)-1,4-diazepan-1-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CCCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H26N2OS/c23-20(16-19-9-15-24-17-19)22-12-5-11-21(13-14-22)10-4-8-18-6-2-1-3-7-18/h1-3,6-7,9,15,17H,4-5,8,10-14,16H2 |
| InChIKey | MGMSKJSXBARNQE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |