C20H26N2O5 — CID 91837500
[1-[5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-carbonyl]piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 91837500) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is [1-[5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-carbonyl]piperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-carbonyl]piperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 91837500 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | [1-[5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-carbonyl]piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | CC(C)(O)C#Cc1ccc(C(=O)N2CCCC(C(=O)N3CCOCC3)C2)o1 |
| InChI | InChI=1S/C20H26N2O5/c1-20(2,25)8-7-16-5-6-17(27-16)19(24)22-9-3-4-15(14-22)18(23)21-10-12-26-13-11-21/h5-6,15,25H,3-4,9-14H2,1-2H3 |
| InChIKey | KUPNRPUCQLBZDK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|