C24H28Cl2N2O4 — CID 90485120
[4-(3,4-dichlorophenyl)piperazin-1-yl]-[5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-yl]methanone;oxolane (PubChem CID 90485120) has the molecular formula C24H28Cl2N2O4 and a molecular weight of 479.40 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)piperazin-1-yl]-[5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-yl]methanone;oxolane.
| Compound Name | [4-(3,4-dichlorophenyl)piperazin-1-yl]-[5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-yl]methanone;oxolane |
|---|---|
| PubChem CID | 90485120 |
| Molecular Formula | C24H28Cl2N2O4 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [4-(3,4-dichlorophenyl)piperazin-1-yl]-[5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-yl]methanone;oxolane |
| SMILES | C1CCOC1.CC(C)(O)C#Cc1ccc(C(=O)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)o1 |
| InChI | InChI=1S/C20H20Cl2N2O3.C4H8O/c1-20(2,26)8-7-15-4-6-18(27-15)19(25)24-11-9-23(10-12-24)14-3-5-16(21)17(22)13-14;1-2-4-5-3-1/h3-6,13,26H,9-12H2,1-2H3;1-4H2 |
| InChIKey | ZIYDJOZCAZQGMQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|