C16H21FN4O2 — CID 91837583
2-[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylamino]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 91837583) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylamino]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylamino]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 91837583 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[(6-fluoro-1H-benzimidazol-2-yl)methyl-methylamino]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CN(CC(=O)NCC1CCCO1)Cc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C16H21FN4O2/c1-21(10-16(22)18-8-12-3-2-6-23-12)9-15-19-13-5-4-11(17)7-14(13)20-15/h4-5,7,12H,2-3,6,8-10H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | MPDMVPHNNYGRDV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |