C19H28N3O4+ — CID 9183819
1-[4-[(1-morpholin-4-ium-4-ylcyclohexyl)methylamino]-3-nitrophenyl]ethanone (PubChem CID 9183819) has the molecular formula C19H28N3O4+ and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-[4-[(1-morpholin-4-ium-4-ylcyclohexyl)methylamino]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[(1-morpholin-4-ium-4-ylcyclohexyl)methylamino]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 9183819 |
| Molecular Formula | C19H28N3O4+ |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-[4-[(1-morpholin-4-ium-4-ylcyclohexyl)methylamino]-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(NCC2([NH+]3CCOCC3)CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H27N3O4/c1-15(23)16-5-6-17(18(13-16)22(24)25)20-14-19(7-3-2-4-8-19)21-9-11-26-12-10-21/h5-6,13,20H,2-4,7-12,14H2,1H3/p+1 |
| InChIKey | JZEJVGRCLDOAOH-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|