C13H19N5O2S — CID 91838845
8-methyl-2-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 91838845) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 8-methyl-2-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 8-methyl-2-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 91838845 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 8-methyl-2-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CNc1nc(CN2CCN3C(=O)CN(C)C(=O)C3C2)cs1 |
| InChI | InChI=1S/C13H19N5O2S/c1-14-13-15-9(8-21-13)5-17-3-4-18-10(6-17)12(20)16(2)7-11(18)19/h8,10H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | RMVHWRPTCXSMBP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |