C13H23N3O — CID 91843670
3-[[2-(ethoxymethyl)pyrrolidin-1-yl]methyl]-1-ethylpyrazole (PubChem CID 91843670) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-[[2-(ethoxymethyl)pyrrolidin-1-yl]methyl]-1-ethylpyrazole.
| Compound Name | 3-[[2-(ethoxymethyl)pyrrolidin-1-yl]methyl]-1-ethylpyrazole |
|---|---|
| PubChem CID | 91843670 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-[[2-(ethoxymethyl)pyrrolidin-1-yl]methyl]-1-ethylpyrazole |
| SMILES | CCOCC1CCCN1Cc1ccn(CC)n1 |
| InChI | InChI=1S/C13H23N3O/c1-3-16-9-7-12(14-16)10-15-8-5-6-13(15)11-17-4-2/h7,9,13H,3-6,8,10-11H2,1-2H3 |
| InChIKey | UBLKFRXYJIQZGM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |