C18H21N3O2S — CID 91843825
4-[[2-[methyl(2-phenylsulfanylethyl)amino]acetyl]amino]benzamide (PubChem CID 91843825) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-[[2-[methyl(2-phenylsulfanylethyl)amino]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[methyl(2-phenylsulfanylethyl)amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 91843825 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-[[2-[methyl(2-phenylsulfanylethyl)amino]acetyl]amino]benzamide |
| SMILES | CN(CCSc1ccccc1)CC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-21(11-12-24-16-5-3-2-4-6-16)13-17(22)20-15-9-7-14(8-10-15)18(19)23/h2-10H,11-13H2,1H3,(H2,19,23)(H,20,22) |
| InChIKey | HGIHFYJSOOCHHL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |