C14H24O11 — CID 91861529
[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-[(2R,3R,4R,5S,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 91861529) has the molecular formula C14H24O11 and a molecular weight of 368.34 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-[(2R,3R,4R,5S,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-[(2R,3R,4R,5S,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91861529 |
| Molecular Formula | C14H24O11 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-[(2R,3R,4R,5S,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](C)O[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H24O11/c1-4-7(16)12(11(20)13(21)23-4)25-14-10(19)9(18)8(17)6(24-14)3-22-5(2)15/h4,6-14,16-21H,3H2,1-2H3/t4-,6+,7-,8-,9-,10+,11+,12+,13+,14-/m0/s1 |
| InChIKey | JSEWJBZIPAVRPN-ALHSJGLPSA-N |
| XLogP | -3.80 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |