C17H21N3O5S — CID 9187026
(E)-3-(4-methoxyphenyl)-N-[(1S)-2-methyl-1-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]prop-2-enamide (PubChem CID 9187026) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[(1S)-2-methyl-1-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[(1S)-2-methyl-1-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 9187026 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[(1S)-2-methyl-1-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N[C@H](c2nnc(S(C)(=O)=O)o2)C(C)C)cc1 |
| InChI | InChI=1S/C17H21N3O5S/c1-11(2)15(16-19-20-17(25-16)26(4,22)23)18-14(21)10-7-12-5-8-13(24-3)9-6-12/h5-11,15H,1-4H3,(H,18,21)/b10-7+/t15-/m0/s1 |
| InChIKey | SABXIUNOIDJIDP-VSGCLNPGSA-N |
| XLogP | 2.01 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|