C10H11ClO2S — CID 91875906
2-(3-chloro-5-ethylsulfanylphenyl)acetic acid (PubChem CID 91875906) has the molecular formula C10H11ClO2S and a molecular weight of 230.72 g/mol. Its IUPAC name is 2-(3-chloro-5-ethylsulfanylphenyl)acetic acid.
| Compound Name | 2-(3-chloro-5-ethylsulfanylphenyl)acetic acid |
|---|---|
| PubChem CID | 91875906 |
| Molecular Formula | C10H11ClO2S |
| Molecular Weight | 230.72 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 2-(3-chloro-5-ethylsulfanylphenyl)acetic acid |
| SMILES | CCSc1cc(Cl)cc(CC(=O)O)c1 |
| InChI | InChI=1S/C10H11ClO2S/c1-2-14-9-4-7(5-10(12)13)3-8(11)6-9/h3-4,6H,2,5H2,1H3,(H,12,13) |
| InChIKey | WJGFAJWINHOLEW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.72 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |