C17H26ClN3OS — CID 9187630
1-[[(2R)-2-(4-chlorophenyl)-3-methylbutanoyl]amino]-3-pentylthiourea (PubChem CID 9187630) has the molecular formula C17H26ClN3OS and a molecular weight of 355.94 g/mol. Its IUPAC name is 1-[[(2R)-2-(4-chlorophenyl)-3-methylbutanoyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[(2R)-2-(4-chlorophenyl)-3-methylbutanoyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9187630 |
| Molecular Formula | C17H26ClN3OS |
| Molecular Weight | 355.94 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[[(2R)-2-(4-chlorophenyl)-3-methylbutanoyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)[C@@H](c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C17H26ClN3OS/c1-4-5-6-11-19-17(23)21-20-16(22)15(12(2)3)13-7-9-14(18)10-8-13/h7-10,12,15H,4-6,11H2,1-3H3,(H,20,22)(H2,19,21,23)/t15-/m1/s1 |
| InChIKey | PCVSLWXJHZSCMO-OAHLLOKOSA-N |
| XLogP | 3.77 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.94 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|