2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid

C14H10BrFO2S — CID 91877435

IUPAC2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid
SMILESO=C(O)Cc1ccc(Sc2ccc(Br)cc2)cc1F
InChIInChI=1S/C14H10BrFO2S/c15-10-2-5-11(6-3-10)19-12-4-1-9(7-14(17)18)13(16)8-12/h1-6,8H,7H2,(H,17,18)
InChIKeyPEDBIMFZYPRSNW-UHFFFAOYSA-N
MW341.20 g/mol
LogP4.37
Rot. Bonds4

About 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid

2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid (PubChem CID 91877435) has the molecular formula C14H10BrFO2S and a molecular weight of 341.20 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid.

Molecular Properties

Compound Name2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid
PubChem CID91877435
Molecular FormulaC14H10BrFO2S
Molecular Weight341.20 g/mol
Exact Mass339.96
IUPAC Name2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid
SMILESO=C(O)Cc1ccc(Sc2ccc(Br)cc2)cc1F
InChIInChI=1S/C14H10BrFO2S/c15-10-2-5-11(6-3-10)19-12-4-1-9(7-14(17)18)13(16)8-12/h1-6,8H,7H2,(H,17,18)
InChIKeyPEDBIMFZYPRSNW-UHFFFAOYSA-N
XLogP4.37
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.20
LogP ≤ 54.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid?
The IUPAC name of 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid (CID 91877435) is 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid.
What is the SMILES notation for 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid?
The canonical SMILES for 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid is O=C(O)Cc1ccc(Sc2ccc(Br)cc2)cc1F.
What is the InChIKey of 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid?
The InChIKey is PEDBIMFZYPRSNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrFO2S/c15-10-2-5-11(6-3-10)19-12-4-1-9(7-14(17)18)13(16)8-12/h1-6,8H,7H2,(H,17,18).
What are the key properties of 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid?
2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid has a molecular weight of 341.20 g/mol, XLogP of 4.37, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-bromophenyl)sulfanyl-2-fluorophenyl]acetic acid is sourced from PubChem (CID 91877435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).