C16H14O5S — CID 91878667
4-[4-(carboxymethyl)-2-methoxyphenyl]sulfanylbenzoic acid (PubChem CID 91878667) has the molecular formula C16H14O5S and a molecular weight of 318.35 g/mol. Its IUPAC name is 4-[4-(carboxymethyl)-2-methoxyphenyl]sulfanylbenzoic acid.
| Compound Name | 4-[4-(carboxymethyl)-2-methoxyphenyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 91878667 |
| Molecular Formula | C16H14O5S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-[4-(carboxymethyl)-2-methoxyphenyl]sulfanylbenzoic acid |
| SMILES | COc1cc(CC(=O)O)ccc1Sc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H14O5S/c1-21-13-8-10(9-15(17)18)2-7-14(13)22-12-5-3-11(4-6-12)16(19)20/h2-8H,9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | YYFPXBZZKNHKSV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |