C17H16O4S — CID 91878674
4-[4-(carboxymethyl)-2-ethylphenyl]sulfanylbenzoic acid (PubChem CID 91878674) has the molecular formula C17H16O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-[4-(carboxymethyl)-2-ethylphenyl]sulfanylbenzoic acid.
| Compound Name | 4-[4-(carboxymethyl)-2-ethylphenyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 91878674 |
| Molecular Formula | C17H16O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-[4-(carboxymethyl)-2-ethylphenyl]sulfanylbenzoic acid |
| SMILES | CCc1cc(CC(=O)O)ccc1Sc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H16O4S/c1-2-12-9-11(10-16(18)19)3-8-15(12)22-14-6-4-13(5-7-14)17(20)21/h3-9H,2,10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | INPMFGIUVCDEFS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |