C14H11NO4S — CID 91879999
4-(4-aminophenyl)sulfanylbenzene-1,3-dicarboxylic acid (PubChem CID 91879999) has the molecular formula C14H11NO4S and a molecular weight of 289.31 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfanylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-(4-aminophenyl)sulfanylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91879999 |
| Molecular Formula | C14H11NO4S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 4-(4-aminophenyl)sulfanylbenzene-1,3-dicarboxylic acid |
| SMILES | Nc1ccc(Sc2ccc(C(=O)O)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C14H11NO4S/c15-9-2-4-10(5-3-9)20-12-6-1-8(13(16)17)7-11(12)14(18)19/h1-7H,15H2,(H,16,17)(H,18,19) |
| InChIKey | QOZYXHBYGJZJIN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|