C12H14O4S — CID 91881319
3-[2-(carboxymethyl)-4-methylsulfanylphenyl]propanoic acid (PubChem CID 91881319) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-[2-(carboxymethyl)-4-methylsulfanylphenyl]propanoic acid.
| Compound Name | 3-[2-(carboxymethyl)-4-methylsulfanylphenyl]propanoic acid |
|---|---|
| PubChem CID | 91881319 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-[2-(carboxymethyl)-4-methylsulfanylphenyl]propanoic acid |
| SMILES | CSc1ccc(CCC(=O)O)c(CC(=O)O)c1 |
| InChI | InChI=1S/C12H14O4S/c1-17-10-4-2-8(3-5-11(13)14)9(6-10)7-12(15)16/h2,4,6H,3,5,7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | GLHGDKDUKCFDQE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |