C19H20F2OS2 — CID 174941517
1,5-bis(2-fluoro-4-methylsulfanylphenyl)pentan-3-one (PubChem CID 174941517) has the molecular formula C19H20F2OS2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 1,5-bis(2-fluoro-4-methylsulfanylphenyl)pentan-3-one.
| Compound Name | 1,5-bis(2-fluoro-4-methylsulfanylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 174941517 |
| Molecular Formula | C19H20F2OS2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1,5-bis(2-fluoro-4-methylsulfanylphenyl)pentan-3-one |
| SMILES | CSc1ccc(CCC(=O)CCc2ccc(SC)cc2F)c(F)c1 |
| InChI | InChI=1S/C19H20F2OS2/c1-23-16-9-5-13(18(20)11-16)3-7-15(22)8-4-14-6-10-17(24-2)12-19(14)21/h5-6,9-12H,3-4,7-8H2,1-2H3 |
| InChIKey | LUXFSNBIGCLANO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |