C11H9NO4 — CID 91883361
2-(2-carboxyethyl)-5-cyanobenzoic acid (PubChem CID 91883361) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-(2-carboxyethyl)-5-cyanobenzoic acid.
| Compound Name | 2-(2-carboxyethyl)-5-cyanobenzoic acid |
|---|---|
| PubChem CID | 91883361 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-(2-carboxyethyl)-5-cyanobenzoic acid |
| SMILES | N#Cc1ccc(CCC(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H9NO4/c12-6-7-1-2-8(3-4-10(13)14)9(5-7)11(15)16/h1-2,5H,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | BCYAKZCXEUJYHX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |