C16H13ClF4N4O — CID 91892338
(2-chloro-4-fluorophenyl)-[4-[6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 91892338) has the molecular formula C16H13ClF4N4O and a molecular weight of 388.75 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[4-[6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[4-[6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 91892338 |
| Molecular Formula | C16H13ClF4N4O |
| Molecular Weight | 388.75 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[4-[6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCN(c2cc(C(F)(F)F)ncn2)CC1 |
| InChI | InChI=1S/C16H13ClF4N4O/c17-12-7-10(18)1-2-11(12)15(26)25-5-3-24(4-6-25)14-8-13(16(19,20)21)22-9-23-14/h1-2,7-9H,3-6H2 |
| InChIKey | SZFRIYSEFWXIIZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.75 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |