C20H18ClFN4O — CID 91904740
(2-chloro-4-fluorophenyl)-[4-(5-phenyl-1H-pyrazol-3-yl)piperazin-1-yl]methanone (PubChem CID 91904740) has the molecular formula C20H18ClFN4O and a molecular weight of 384.84 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[4-(5-phenyl-1H-pyrazol-3-yl)piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[4-(5-phenyl-1H-pyrazol-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 91904740 |
| Molecular Formula | C20H18ClFN4O |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[4-(5-phenyl-1H-pyrazol-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCN(c2cc(-c3ccccc3)[nH]n2)CC1 |
| InChI | InChI=1S/C20H18ClFN4O/c21-17-12-15(22)6-7-16(17)20(27)26-10-8-25(9-11-26)19-13-18(23-24-19)14-4-2-1-3-5-14/h1-7,12-13H,8-11H2,(H,23,24) |
| InChIKey | UJCAZQIRODLCRN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |