C22H23N3O5S — CID 91892551
N-benzyl-4-[(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)methyl]benzamide (PubChem CID 91892551) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-benzyl-4-[(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)methyl]benzamide.
| Compound Name | N-benzyl-4-[(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 91892551 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-benzyl-4-[(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(CN2C(=O)NC3(CCS(=O)(=O)CC3)C2=O)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c26-19(23-14-16-4-2-1-3-5-16)18-8-6-17(7-9-18)15-25-20(27)22(24-21(25)28)10-12-31(29,30)13-11-22/h1-9H,10-15H2,(H,23,26)(H,24,28) |
| InChIKey | MIZSXQXUUSOBQT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|