C10H7N3OS2 — CID 91899621
3-(1,3-benzothiazol-2-yl)-4-hydroxy-1H-imidazole-2-thione (PubChem CID 91899621) has the molecular formula C10H7N3OS2 and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4-hydroxy-1H-imidazole-2-thione.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4-hydroxy-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 91899621 |
| Molecular Formula | C10H7N3OS2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4-hydroxy-1H-imidazole-2-thione |
| SMILES | Oc1c[nH]c(=S)n1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H7N3OS2/c14-8-5-11-9(15)13(8)10-12-6-3-1-2-4-7(6)16-10/h1-5,14H,(H,11,15) |
| InChIKey | XEOBOVLNPUJBPN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|