C21H29N2O16S3-3 — CID 91900385
[(2R,3R,4S,5S,6S)-2-[[[2-[ethyl(4-phenylbutanoyl)amino]acetyl]amino]methyl]-6-methoxy-3,5-disulfonatooxyoxan-4-yl] sulfate (PubChem CID 91900385) has the molecular formula C21H29N2O16S3-3 and a molecular weight of 661.66 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2-[[[2-[ethyl(4-phenylbutanoyl)amino]acetyl]amino]methyl]-6-methoxy-3,5-disulfonatooxyoxan-4-yl] sulfate.
| Compound Name | [(2R,3R,4S,5S,6S)-2-[[[2-[ethyl(4-phenylbutanoyl)amino]acetyl]amino]methyl]-6-methoxy-3,5-disulfonatooxyoxan-4-yl] sulfate |
|---|---|
| PubChem CID | 91900385 |
| Molecular Formula | C21H29N2O16S3-3 |
| Molecular Weight | 661.66 g/mol |
| Exact Mass | 661.07 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2-[[[2-[ethyl(4-phenylbutanoyl)amino]acetyl]amino]methyl]-6-methoxy-3,5-disulfonatooxyoxan-4-yl] sulfate |
| SMILES | CCN(CC(=O)NC[C@H]1O[C@H](OC)[C@@H](OS(=O)(=O)[O-])[C@@H](OS(=O)(=O)[O-])[C@@H]1OS(=O)(=O)[O-])C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C21H32N2O16S3/c1-3-23(17(25)11-7-10-14-8-5-4-6-9-14)13-16(24)22-12-15-18(37-40(26,27)28)19(38-41(29,30)31)20(21(35-2)36-15)39-42(32,33)34/h4-6,8-9,15,18-21H,3,7,10-13H2,1-2H3,(H,22,24)(H,26,27,28)(H,29,30,31)(H,32,33,34)/p-3/t15-,18-,19+,20+,21+/m1/s1 |
| InChIKey | RVDSDHOGRRBRKV-MKCNHSFFSA-K |
| XLogP | -2.12 |
| TPSA | 267.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.66 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|