C20H30N2NaO20S4+ — CID 11274266
sodium [(2R,3S,4S,5R,6R)-2-[2-[[2-[acetyl(2-phenylethyl)amino]acetyl]amino]ethoxy]-3,5-disulfooxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate (PubChem CID 11274266) has the molecular formula C20H30N2NaO20S4+ and a molecular weight of 769.71 g/mol. Its IUPAC name is sodium [(2R,3S,4S,5R,6R)-2-[2-[[2-[acetyl(2-phenylethyl)amino]acetyl]amino]ethoxy]-3,5-disulfooxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate.
| Compound Name | sodium [(2R,3S,4S,5R,6R)-2-[2-[[2-[acetyl(2-phenylethyl)amino]acetyl]amino]ethoxy]-3,5-disulfooxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 11274266 |
| Molecular Formula | C20H30N2NaO20S4+ |
| Molecular Weight | 769.71 g/mol |
| Exact Mass | 769.02 |
| IUPAC Name | sodium [(2R,3S,4S,5R,6R)-2-[2-[[2-[acetyl(2-phenylethyl)amino]acetyl]amino]ethoxy]-3,5-disulfooxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate |
| SMILES | CC(=O)N(CCc1ccccc1)CC(=O)NCCO[C@@H]1O[C@H](COS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@@H]1OS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C20H30N2O20S4.Na/c1-13(23)22(9-7-14-5-3-2-4-6-14)11-16(24)21-8-10-37-20-19(42-46(34,35)36)18(41-45(31,32)33)17(40-44(28,29)30)15(39-20)12-38-43(25,26)27;/h2-6,15,17-20H,7-12H2,1H3,(H,21,24)(H,25,26,27)(H,28,29,30)(H,31,32,33)(H,34,35,36);/q;+1/t15-,17-,18+,19+,20-;/m1./s1 |
| InChIKey | PBSDXJMMXOUUBT-YAMQMQJWSA-N |
| XLogP | -5.68 |
| TPSA | 322.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.71 |
| LogP ≤ 5 | -5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|