C10H11N3O2S — CID 91901890
1-(3,4-dimethylphenyl)sulfonyl-1,2,4-triazole (PubChem CID 91901890) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-1,2,4-triazole.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-1,2,4-triazole |
|---|---|
| PubChem CID | 91901890 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-1,2,4-triazole |
| SMILES | Cc1ccc(S(=O)(=O)n2cncn2)cc1C |
| InChI | InChI=1S/C10H11N3O2S/c1-8-3-4-10(5-9(8)2)16(14,15)13-7-11-6-12-13/h3-7H,1-2H3 |
| InChIKey | OVUORQMMECSVAD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |