C23H28FN3O3 — CID 91903601
N-(2-fluorophenyl)-4-[2-[[2-(4-methylphenoxy)acetyl]amino]ethyl]piperidine-1-carboxamide (PubChem CID 91903601) has the molecular formula C23H28FN3O3 and a molecular weight of 413.49 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-[2-[[2-(4-methylphenoxy)acetyl]amino]ethyl]piperidine-1-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-[2-[[2-(4-methylphenoxy)acetyl]amino]ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91903601 |
| Molecular Formula | C23H28FN3O3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-(2-fluorophenyl)-4-[2-[[2-(4-methylphenoxy)acetyl]amino]ethyl]piperidine-1-carboxamide |
| SMILES | Cc1ccc(OCC(=O)NCCC2CCN(C(=O)Nc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C23H28FN3O3/c1-17-6-8-19(9-7-17)30-16-22(28)25-13-10-18-11-14-27(15-12-18)23(29)26-21-5-3-2-4-20(21)24/h2-9,18H,10-16H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | WNTSCXNWVQOJKS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |