C22H33N3O2 — CID 91913260
4-[2-[(2-cyclopentylacetyl)amino]ethyl]-N-(2-methylphenyl)piperidine-1-carboxamide (PubChem CID 91913260) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 4-[2-[(2-cyclopentylacetyl)amino]ethyl]-N-(2-methylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-[2-[(2-cyclopentylacetyl)amino]ethyl]-N-(2-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91913260 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 4-[2-[(2-cyclopentylacetyl)amino]ethyl]-N-(2-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1ccccc1NC(=O)N1CCC(CCNC(=O)CC2CCCC2)CC1 |
| InChI | InChI=1S/C22H33N3O2/c1-17-6-2-5-9-20(17)24-22(27)25-14-11-18(12-15-25)10-13-23-21(26)16-19-7-3-4-8-19/h2,5-6,9,18-19H,3-4,7-8,10-16H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | KKVWOMITDKEJOJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |