C13H18ClNO3S — CID 91905739
3-chloro-N,4-dimethyl-N-(oxolan-3-ylmethyl)benzenesulfonamide (PubChem CID 91905739) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 3-chloro-N,4-dimethyl-N-(oxolan-3-ylmethyl)benzenesulfonamide.
| Compound Name | 3-chloro-N,4-dimethyl-N-(oxolan-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91905739 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-chloro-N,4-dimethyl-N-(oxolan-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC2CCOC2)cc1Cl |
| InChI | InChI=1S/C13H18ClNO3S/c1-10-3-4-12(7-13(10)14)19(16,17)15(2)8-11-5-6-18-9-11/h3-4,7,11H,5-6,8-9H2,1-2H3 |
| InChIKey | LUTJNOZYGXGHPP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |