C20H26ClFN2O4 — CID 91906169
N-[1-(3-chloro-4-fluorobenzoyl)piperidin-4-yl]-2-methoxy-N-(oxan-4-yl)acetamide (PubChem CID 91906169) has the molecular formula C20H26ClFN2O4 and a molecular weight of 412.89 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorobenzoyl)piperidin-4-yl]-2-methoxy-N-(oxan-4-yl)acetamide.
| Compound Name | N-[1-(3-chloro-4-fluorobenzoyl)piperidin-4-yl]-2-methoxy-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 91906169 |
| Molecular Formula | C20H26ClFN2O4 |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[1-(3-chloro-4-fluorobenzoyl)piperidin-4-yl]-2-methoxy-N-(oxan-4-yl)acetamide |
| SMILES | COCC(=O)N(C1CCOCC1)C1CCN(C(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H26ClFN2O4/c1-27-13-19(25)24(16-6-10-28-11-7-16)15-4-8-23(9-5-15)20(26)14-2-3-18(22)17(21)12-14/h2-3,12,15-16H,4-11,13H2,1H3 |
| InChIKey | SWBYOJYVIPVLQG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |