C16H16N4O5S — CID 91906569
[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate (PubChem CID 91906569) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is [3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate.
| Compound Name | [3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 91906569 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate |
| SMILES | CC1=NS(=O)(=O)N(C)C=C1C(=O)OCc1nc(-c2cccc(C)c2)no1 |
| InChI | InChI=1S/C16H16N4O5S/c1-10-5-4-6-12(7-10)15-17-14(25-18-15)9-24-16(21)13-8-20(3)26(22,23)19-11(13)2/h4-8H,9H2,1-3H3 |
| InChIKey | LBAHZSTWGISBBD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 114.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |