C16H16N4O6S — CID 91906576
[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate (PubChem CID 91906576) has the molecular formula C16H16N4O6S and a molecular weight of 392.39 g/mol. Its IUPAC name is [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate.
| Compound Name | [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 91906576 |
| Molecular Formula | C16H16N4O6S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2,5-dimethyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate |
| SMILES | COc1cccc(-c2noc(COC(=O)C3=CN(C)S(=O)(=O)N=C3C)n2)c1 |
| InChI | InChI=1S/C16H16N4O6S/c1-10-13(8-20(2)27(22,23)19-10)16(21)25-9-14-17-15(18-26-14)11-5-4-6-12(7-11)24-3/h4-8H,9H2,1-3H3 |
| InChIKey | CCDCNNXUPOWZFY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 124.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |