C21H21F3N4O2 — CID 91908700
2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 91908700) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 91908700 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-(5-methyl-2-oxo-1,4,8-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-4-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc2nc3n(c(=O)c2n1CC(=O)Nc1cccc(C(F)(F)F)c1)CCCCC3 |
| InChI | InChI=1S/C21H21F3N4O2/c1-13-10-16-19(20(30)27-9-4-2-3-8-17(27)26-16)28(13)12-18(29)25-15-7-5-6-14(11-15)21(22,23)24/h5-7,10-11H,2-4,8-9,12H2,1H3,(H,25,29) |
| InChIKey | LGBJUSIZKGFXKJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |