C18H23ClN4O4 — CID 91909895
N-(3-chlorophenyl)-2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidine-1-carboxamide (PubChem CID 91909895) has the molecular formula C18H23ClN4O4 and a molecular weight of 394.86 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91909895 |
| Molecular Formula | C18H23ClN4O4 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(3-chlorophenyl)-2-[5-(2-methoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidine-1-carboxamide |
| SMILES | COCCOCc1nc(C2CCCCN2C(=O)Nc2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C18H23ClN4O4/c1-25-9-10-26-12-16-21-17(22-27-16)15-7-2-3-8-23(15)18(24)20-14-6-4-5-13(19)11-14/h4-6,11,15H,2-3,7-10,12H2,1H3,(H,20,24) |
| InChIKey | OCVMAYTZJLHTBO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|