C24H27FN2O2 — CID 91912163
4-fluoro-N-[(1R,5S)-8-(4-phenylbutanoyl)-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 91912163) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is 4-fluoro-N-[(1R,5S)-8-(4-phenylbutanoyl)-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 4-fluoro-N-[(1R,5S)-8-(4-phenylbutanoyl)-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 91912163 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 4-fluoro-N-[(1R,5S)-8-(4-phenylbutanoyl)-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | O=C(NC1C[C@H]2CC[C@@H](C1)N2C(=O)CCCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H27FN2O2/c25-19-11-9-18(10-12-19)24(29)26-20-15-21-13-14-22(16-20)27(21)23(28)8-4-7-17-5-2-1-3-6-17/h1-3,5-6,9-12,20-22H,4,7-8,13-16H2,(H,26,29)/t20?,21-,22+ |
| InChIKey | SYMDAEYXRJAYAV-FRIKZZABSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |