C22H21F5N2O — CID 45144983
2,3,4,5,6-pentafluoro-N-[8-(2-phenylethyl)-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 45144983) has the molecular formula C22H21F5N2O and a molecular weight of 424.41 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[8-(2-phenylethyl)-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[8-(2-phenylethyl)-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 45144983 |
| Molecular Formula | C22H21F5N2O |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[8-(2-phenylethyl)-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | O=C(NC1CC2CCC(C1)N2CCc1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H21F5N2O/c23-17-16(18(24)20(26)21(27)19(17)25)22(30)28-13-10-14-6-7-15(11-13)29(14)9-8-12-4-2-1-3-5-12/h1-5,13-15H,6-11H2,(H,28,30) |
| InChIKey | DAZQSWILRMBCJV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|