C22H19F5N2O3 — CID 45144948
N-[8-(1,3-benzodioxol-5-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 45144948) has the molecular formula C22H19F5N2O3 and a molecular weight of 454.40 g/mol. Its IUPAC name is N-[8-(1,3-benzodioxol-5-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[8-(1,3-benzodioxol-5-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 45144948 |
| Molecular Formula | C22H19F5N2O3 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[8-(1,3-benzodioxol-5-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(NC1CC2CCC(C1)N2Cc1ccc2c(c1)OCO2)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H19F5N2O3/c23-17-16(18(24)20(26)21(27)19(17)25)22(30)28-11-6-12-2-3-13(7-11)29(12)8-10-1-4-14-15(5-10)32-9-31-14/h1,4-5,11-13H,2-3,6-9H2,(H,28,30) |
| InChIKey | VAHRLKOVVBRFDQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|